{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyO/Pafq/n0HsCJL97lqmyPJ",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"
"
]
},
{
"cell_type": "markdown",
"source": [
"Virtual screening"
],
"metadata": {
"id": "IwnuqmRtAmlY"
}
},
{
"cell_type": "code",
"source": [
"!pip install rdkit"
],
"metadata": {
"id": "wS_ngR5dEm9p"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {
"id": "PMKUrKwU_N6_"
},
"outputs": [],
"source": [
"from pathlib import Path\n",
"\n",
"import pandas as pd\n",
"import matplotlib.pyplot as plt\n",
"from rdkit import Chem, DataStructs\n",
"from rdkit.Chem import (\n",
" PandasTools,\n",
" Draw,\n",
" Descriptors,\n",
" MACCSkeys,\n",
" rdFingerprintGenerator,\n",
")"
]
},
{
"cell_type": "code",
"source": [
"# Molecules in SMILES format\n",
"molecule_smiles = [\n",
" \"CC1C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O\",\n",
" \"CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=C(C=C3)O)N)C(=O)O)C\",\n",
" \"C1=COC(=C1)CNC2=CC(=C(C=C2C(=O)O)S(=O)(=O)N)Cl\",\n",
" \"CCCCCCCCCCCC(=O)OCCOC(=O)CCCCCCCCCCC\",\n",
" \"C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl\",\n",
" \"CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C\",\n",
" \"CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O\",\n",
" \"CC1C(CC(=O)C2=C1C=CC=C2O)C(=O)O\",\n",
"]\n",
"\n",
"# List of molecule names\n",
"molecule_names = [\n",
" \"Doxycycline\",\n",
" \"Amoxicilline\",\n",
" \"Furosemide\",\n",
" \"Glycol dilaurate\",\n",
" \"Hydrochlorothiazide\",\n",
" \"Isotretinoin\",\n",
" \"Tetracycline\",\n",
" \"Hemi-cycline D\",\n",
"]"
],
"metadata": {
"id": "9M3RgOqhEvfE"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecules = pd.DataFrame({\"smiles\": molecule_smiles, \"name\": molecule_names})\n",
"PandasTools.AddMoleculeColumnToFrame(molecules, smilesCol=\"smiles\")\n",
"# Show first 2 molecules\n",
"molecules.head(2)"
],
"metadata": {
"id": "iJBPaUowEx7y"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"Draw.MolsToGridImage(\n",
" molecules[\"ROMol\"].to_list(),\n",
" molsPerRow=3,\n",
" subImgSize=(450, 150),\n",
" legends=molecules[\"name\"].to_list(),\n",
")"
],
"metadata": {
"id": "NqrhlCJzE3no"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Note -- we use pandas apply function to apply the MolWt function\n",
"# to all ROMol objects in the DataFrame\n",
"molecules[\"molecule_weight\"] = molecules.ROMol.apply(Descriptors.MolWt)\n",
"# Sort molecules by molecular weight\n",
"molecules.sort_values([\"molecule_weight\"], ascending=False, inplace=True)"
],
"metadata": {
"id": "L3BUmluyFA24"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Show only molecule names and molecular weights\n",
"molecules[[\"smiles\", \"name\", \"molecule_weight\"]]"
],
"metadata": {
"id": "4ndk80ByFEHw"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"Draw.MolsToGridImage(\n",
" molecules[\"ROMol\"],\n",
" legends=[\n",
" f\"{molecule['name']}: {molecule['molecule_weight']:.2f} Da\"\n",
" for index, molecule in molecules.iterrows()\n",
" ],\n",
" subImgSize=(450, 150),\n",
" molsPerRow=3,\n",
")"
],
"metadata": {
"id": "QMDormacFJkh"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecule = molecules[\"ROMol\"][0]\n",
"molecule"
],
"metadata": {
"colab": {
"base_uri": "https://localhost:8080/"
},
"id": "EdmfQDZKFPmx",
"outputId": "8d6f0066-28da-47df-c51c-790e158ceaf0"
},
"execution_count": null,
"outputs": [
{
"output_type": "execute_result",
"data": {
"text/plain": [
""
]
},
"metadata": {},
"execution_count": 10
}
]
},
{
"cell_type": "code",
"source": [
"maccs_fp = MACCSkeys.GenMACCSKeys(molecule)"
],
"metadata": {
"id": "oYpCd1wnFV4p"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecules[\"maccs\"] = molecules.ROMol.apply(MACCSkeys.GenMACCSKeys)"
],
"metadata": {
"id": "Akm0V6NrFaji"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"circular_int_fp = rdFingerprintGenerator.GetCountFPs([molecule])[0]\n",
"circular_int_fp"
],
"metadata": {
"id": "XhIpW23cFgoR"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"print(f\"Print non-zero elements:\\n{circular_int_fp.GetNonzeroElements()}\")"
],
"metadata": {
"id": "PUdhmhz9FkSB"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Note that the function takes a list as input parameter\n",
"# (even if we only want to pass one molecule)\n",
"circular_bit_fp = rdFingerprintGenerator.GetFPs([molecule])[0]\n",
"circular_bit_fp"
],
"metadata": {
"id": "5wY0TR5DFocC"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"print(f\"Print top 400 fingerprint bits:\\n{circular_bit_fp.ToBitString()[:400]}\")"
],
"metadata": {
"id": "Kcc-7JeIFspR"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecules[\"morgan\"] = rdFingerprintGenerator.GetFPs(molecules[\"ROMol\"].tolist())"
],
"metadata": {
"id": "wdt0ZnleFx5q"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Example molecules\n",
"molecule1 = molecules[\"ROMol\"][0]\n",
"molecule2 = molecules[\"ROMol\"][1]\n",
"\n",
"# Example fingerprints\n",
"maccs_fp1 = MACCSkeys.GenMACCSKeys(molecule1)\n",
"maccs_fp2 = MACCSkeys.GenMACCSKeys(molecule2)"
],
"metadata": {
"id": "-QcPiu3QF3Eh"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"DataStructs.TanimotoSimilarity(maccs_fp1, maccs_fp2)"
],
"metadata": {
"id": "Y_DmsFphF5vj"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define molecule query and list\n",
"molecule_query = molecules[\"maccs\"][0]\n",
"molecule_list = molecules[\"maccs\"].to_list()\n",
"# Calculate similarty values between query and list elements\n",
"molecules[\"tanimoto_maccs\"] = DataStructs.BulkTanimotoSimilarity(molecule_query, molecule_list)\n",
"molecules[\"dice_maccs\"] = DataStructs.BulkDiceSimilarity(molecule_query, molecule_list)"
],
"metadata": {
"id": "KXZq_0ghGDyK"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"preview = molecules.sort_values([\"tanimoto_maccs\"], ascending=False).reset_index()\n",
"preview[[\"name\", \"tanimoto_maccs\", \"dice_maccs\"]]"
],
"metadata": {
"id": "oLBgsIQDGIrB"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def draw_ranked_molecules(molecules, sort_by_column):\n",
" \"\"\"\n",
" Draw molecules sorted by a given column.\n",
"\n",
" Parameters\n",
" ----------\n",
" molecules : pandas.DataFrame\n",
" Molecules (with \"ROMol\" and \"name\" columns and a column to sort by.\n",
" sort_by_column : str\n",
" Name of the column used to sort the molecules by.\n",
"\n",
" Returns\n",
" -------\n",
" Draw.MolsToGridImage\n",
" 2D visualization of sorted molecules.\n",
" \"\"\"\n",
"\n",
" molecules_sorted = molecules.sort_values([sort_by_column], ascending=False).reset_index()\n",
" return Draw.MolsToGridImage(\n",
" molecules_sorted[\"ROMol\"],\n",
" legends=[\n",
" f\"#{index+1} {molecule['name']}, similarity={molecule[sort_by_column]:.2f}\"\n",
" for index, molecule in molecules_sorted.iterrows()\n",
" ],\n",
" molsPerRow=3,\n",
" subImgSize=(450, 150),\n",
" )"
],
"metadata": {
"id": "3XGUf57tGRHI"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"draw_ranked_molecules(molecules, \"tanimoto_maccs\")"
],
"metadata": {
"id": "1GaWEV_xGV8I"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define molecule query and list\n",
"molecule_query = molecules[\"morgan\"][0]\n",
"molecule_list = molecules[\"morgan\"].to_list()\n",
"# Calculate similarty values between query and list elements\n",
"molecules[\"tanimoto_morgan\"] = DataStructs.BulkTanimotoSimilarity(molecule_query, molecule_list)\n",
"molecules[\"dice_morgan\"] = DataStructs.BulkDiceSimilarity(molecule_query, molecule_list)"
],
"metadata": {
"id": "IODdVQqKGgMB"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"preview = molecules.sort_values([\"tanimoto_morgan\"], ascending=False).reset_index()\n",
"preview[[\"name\", \"tanimoto_morgan\", \"dice_morgan\", \"tanimoto_maccs\", \"dice_maccs\"]]\n"
],
"metadata": {
"id": "fivuZHjlGipq"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"draw_ranked_molecules(molecules, \"tanimoto_morgan\")"
],
"metadata": {
"id": "UHv5-rSKGqbt"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"fig, ax = plt.subplots(figsize=(6, 6))\n",
"molecules.plot(\"tanimoto_maccs\", \"tanimoto_morgan\", kind=\"scatter\", ax=ax)\n",
"ax.plot([0, 1], [0, 1], \"k--\")\n",
"ax.set_xlabel(\"Tanimoto (MACCS)\")\n",
"ax.set_ylabel(\"Tanimoto (Morgan)\")\n",
"fig;"
],
"metadata": {
"id": "3o5w6sDyGwYN"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecule_dataset = pd.read_csv(\n",
" \"TNFB_compounds_lipinski.csv\",\n",
" usecols=[\"molecule_chembl_id\", \"smiles\", \"pIC50\"],\n",
")\n",
"print(f\"Number of molecules in dataset: {len(molecule_dataset)}\")\n",
"molecule_dataset.head(5)"
],
"metadata": {
"id": "wH-Q8hyv9XZn"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"query = Chem.MolFromSmiles(\"O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cnc(Cl)nc1C(F)(F)F\")\n",
"query"
],
"metadata": {
"id": "3WmxmCzj97WQ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"maccs_fp_query = MACCSkeys.GenMACCSKeys(query)\n",
"circular_fp_query = rdFingerprintGenerator.GetCountFPs([query])[0]"
],
"metadata": {
"id": "GkcDaxez-OuP"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"PandasTools.AddMoleculeColumnToFrame(molecule_dataset, \"smiles\")\n",
"circular_fp_list = rdFingerprintGenerator.GetCountFPs(molecule_dataset[\"ROMol\"].tolist())\n",
"maccs_fp_list = molecule_dataset[\"ROMol\"].apply(MACCSkeys.GenMACCSKeys).tolist()"
],
"metadata": {
"id": "n2bzjaPD-SfH"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecule_dataset[\"tanimoto_maccs\"] = DataStructs.BulkTanimotoSimilarity(\n",
" maccs_fp_query, maccs_fp_list\n",
")\n",
"molecule_dataset[\"tanimoto_morgan\"] = DataStructs.BulkTanimotoSimilarity(\n",
" circular_fp_query, circular_fp_list\n",
")"
],
"metadata": {
"id": "fxxsJrac-WAw"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecule_dataset[\"dice_maccs\"] = DataStructs.BulkDiceSimilarity(maccs_fp_query, maccs_fp_list)\n",
"molecule_dataset[\"dice_morgan\"] = DataStructs.BulkDiceSimilarity(\n",
" circular_fp_query, circular_fp_list\n",
")"
],
"metadata": {
"id": "PQT4ako_-YoL"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# NBVAL_CHECK_OUTPUT\n",
"molecule_dataset[\n",
" [\"smiles\", \"tanimoto_maccs\", \"tanimoto_morgan\", \"dice_maccs\", \"dice_morgan\"]\n",
"].head(5)"
],
"metadata": {
"id": "6ESskO7s-aVb"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Show all columns\n",
"molecule_dataset.head(3)"
],
"metadata": {
"id": "4lvx2Tx--fkQ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"fig, axes = plt.subplots(figsize=(10, 6), nrows=2, ncols=2)\n",
"molecule_dataset.hist([\"tanimoto_maccs\"], ax=axes[0, 0])\n",
"molecule_dataset.hist([\"tanimoto_morgan\"], ax=axes[0, 1])\n",
"molecule_dataset.hist([\"dice_maccs\"], ax=axes[1, 0])\n",
"molecule_dataset.hist([\"dice_morgan\"], ax=axes[1, 1])\n",
"axes[1, 0].set_xlabel(\"similarity value\")\n",
"axes[1, 0].set_ylabel(\"# molecules\")\n",
"fig;"
],
"metadata": {
"id": "7mySir-w-kah"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"fig, axes = plt.subplots(figsize=(12, 6), nrows=1, ncols=2)\n",
"\n",
"molecule_dataset.plot(\"tanimoto_maccs\", \"dice_maccs\", kind=\"scatter\", ax=axes[0])\n",
"axes[0].plot([0, 1], [0, 1], \"k--\")\n",
"axes[0].set_xlabel(\"Tanimoto (MACCS)\")\n",
"axes[0].set_ylabel(\"Dice (MACCS)\")\n",
"\n",
"molecule_dataset.plot(\"tanimoto_morgan\", \"dice_morgan\", kind=\"scatter\", ax=axes[1])\n",
"axes[1].plot([0, 1], [0, 1], \"k--\")\n",
"axes[1].set_xlabel(\"Tanimoto (Morgan)\")\n",
"axes[1].set_ylabel(\"Dice (Morgan)\")\n",
"\n",
"fig;"
],
"metadata": {
"id": "FMB6Qty1-pbn"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecule_dataset.sort_values([\"tanimoto_morgan\"], ascending=False).head(3)"
],
"metadata": {
"id": "4UzFAWc6-ykA"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"top_n_molecules = 10\n",
"top_molecules = molecule_dataset.sort_values([\"tanimoto_morgan\"], ascending=False).reset_index()\n",
"top_molecules = top_molecules[:top_n_molecules]\n",
"legends = [\n",
" f\"#{index+1} {molecule['molecule_chembl_id']}, pIC50={molecule['pIC50']:.2f}\"\n",
" for index, molecule in top_molecules.iterrows()\n",
"]\n",
"Chem.Draw.MolsToGridImage(\n",
" mols=[query] + top_molecules[\"ROMol\"].tolist(),\n",
" legends=([\"Gefitinib\"] + legends),\n",
" molsPerRow=3,\n",
" subImgSize=(450, 150),\n",
")"
],
"metadata": {
"id": "BgcxSuAj-6gv"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"molecule_dataset.head(3)"
],
"metadata": {
"id": "u0tFvI4Y_Msf"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def get_enrichment_data(molecules, similarity_measure, pic50_cutoff):\n",
" \"\"\"\n",
" Calculates x and y values for enrichment plot:\n",
" x - % ranked dataset\n",
" y - % true actives identified\n",
"\n",
" Parameters\n",
" ----------\n",
" molecules : pandas.DataFrame\n",
" Molecules with similarity values to a query molecule.\n",
" similarity_measure : str\n",
" Column name which will be used to sort the DataFrame.\n",
" pic50_cutoff : float\n",
" pIC50 cutoff value used to discriminate active and inactive molecules.\n",
"\n",
" Returns\n",
" -------\n",
" pandas.DataFrame\n",
" Enrichment data: Percentage of ranked dataset by similarity vs. percentage of identified true actives.\n",
" \"\"\"\n",
"\n",
" # Get number of molecules in data set\n",
" molecules_all = len(molecules)\n",
"\n",
" # Get number of active molecules in data set\n",
" actives_all = sum(molecules[\"pIC50\"] >= pic50_cutoff)\n",
"\n",
" # Initialize a list that will hold the counter for actives and molecules while iterating through our dataset\n",
" actives_counter_list = []\n",
"\n",
" # Initialize counter for actives\n",
" actives_counter = 0\n",
"\n",
" # Note: Data must be ranked for enrichment plots:\n",
" # Sort molecules by selected similarity measure\n",
" molecules.sort_values([similarity_measure], ascending=False, inplace=True)\n",
"\n",
" # Iterate over the ranked dataset and check each molecule if active (by checking bioactivity)\n",
" for value in molecules[\"pIC50\"]:\n",
" if value >= pic50_cutoff:\n",
" actives_counter += 1\n",
" actives_counter_list.append(actives_counter)\n",
"\n",
" # Transform number of molecules into % ranked dataset\n",
" molecules_percentage_list = [i / molecules_all for i in range(1, molecules_all + 1)]\n",
"\n",
" # Transform number of actives into % true actives identified\n",
" actives_percentage_list = [i / actives_all for i in actives_counter_list]\n",
"\n",
" # Generate DataFrame with x and y values as well as label\n",
" enrichment = pd.DataFrame(\n",
" {\n",
" \"% ranked dataset\": molecules_percentage_list,\n",
" \"% true actives identified\": actives_percentage_list,\n",
" }\n",
" )\n",
"\n",
" return enrichment"
],
"metadata": {
"id": "GupUIRiM_Pin"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"pic50_cutoff = 6.3"
],
"metadata": {
"id": "KdgWp1l8_T4L"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"similarity_measures = [\"tanimoto_maccs\", \"tanimoto_morgan\"]\n",
"enrichment_data = {\n",
" similarity_measure: get_enrichment_data(molecule_dataset, similarity_measure, pic50_cutoff)\n",
" for similarity_measure in similarity_measures\n",
"}"
],
"metadata": {
"id": "mEKlMs7q_XG_"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# NBVAL_CHECK_OUTPUT\n",
"enrichment_data[\"tanimoto_maccs\"].head()"
],
"metadata": {
"id": "58Jqhzk__ZHX"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"fig, ax = plt.subplots(figsize=(6, 6))\n",
"\n",
"fontsize = 20\n",
"\n",
"# Plot enrichment data\n",
"for similarity_measure, enrichment in enrichment_data.items():\n",
" ax = enrichment.plot(\n",
" ax=ax,\n",
" x=\"% ranked dataset\",\n",
" y=\"% true actives identified\",\n",
" label=similarity_measure,\n",
" alpha=0.5,\n",
" linewidth=4,\n",
" )\n",
"ax.set_ylabel(\"% True actives identified\", size=fontsize)\n",
"ax.set_xlabel(\"% Ranked dataset\", size=fontsize)\n",
"\n",
"# Plot optimal curve: Ratio of actives in dataset\n",
"ratio_actives = sum(molecule_dataset[\"pIC50\"] >= pic50_cutoff) / len(molecule_dataset)\n",
"ax.plot(\n",
" [0, ratio_actives, 1],\n",
" [0, 1, 1],\n",
" label=\"Optimal curve\",\n",
" color=\"black\",\n",
" linestyle=\"--\",\n",
")\n",
"\n",
"# Plot random curve\n",
"ax.plot([0, 1], [0, 1], label=\"Random curve\", color=\"grey\", linestyle=\"--\")\n",
"\n",
"plt.tick_params(labelsize=16)\n",
"plt.legend(\n",
" labels=[\"MACCS\", \"Morgan\", \"Optimal\", \"Random\"],\n",
" loc=(0.5, 0.08),\n",
" fontsize=fontsize,\n",
" labelspacing=0.3,\n",
")\n",
"\n",
"# Save plot -- use bbox_inches to include text boxes\n",
"plt.savefig(\n",
" \"enrichment_plot.png\",\n",
" dpi=300,\n",
" bbox_inches=\"tight\",\n",
" transparent=True,\n",
")\n",
"\n",
"plt.show()"
],
"metadata": {
"id": "8is59ZNb_ctY"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def calculate_enrichment_factor(enrichment, ranked_dataset_percentage_cutoff):\n",
" \"\"\"\n",
" Get the experimental enrichment factor for a given percentage of the ranked dataset.\n",
"\n",
" Parameters\n",
" ----------\n",
" enrichment : pd.DataFrame\n",
" Enrichment data: Percentage of ranked dataset by similarity vs. percentage of\n",
" identified true actives.\n",
" ranked_dataset_percentage_cutoff : float or int\n",
" Percentage of ranked dataset to be included in enrichment factor calculation.\n",
"\n",
" Returns\n",
" -------\n",
" float\n",
" Experimental enrichment factor.\n",
" \"\"\"\n",
"\n",
" # Keep only molecules that meet the cutoff\n",
" enrichment = enrichment[\n",
" enrichment[\"% ranked dataset\"] <= ranked_dataset_percentage_cutoff / 100\n",
" ]\n",
" # Get highest percentage of actives and the corresponding percentage of actives\n",
" highest_enrichment = enrichment.iloc[-1]\n",
" enrichment_factor = round(100 * float(highest_enrichment[\"% true actives identified\"]), 1)\n",
" return enrichment_factor"
],
"metadata": {
"id": "XUWbwjU7_uBR"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def calculate_enrichment_factor_random(ranked_dataset_percentage_cutoff):\n",
" \"\"\"\n",
" Get the random enrichment factor for a given percentage of the ranked dataset.\n",
"\n",
" Parameters\n",
" ----------\n",
" ranked_dataset_percentage_cutoff : float or int\n",
" Percentage of ranked dataset to be included in enrichment factor calculation.\n",
"\n",
" Returns\n",
" -------\n",
" float\n",
" Random enrichment factor.\n",
" \"\"\"\n",
"\n",
" enrichment_factor_random = round(float(ranked_dataset_percentage_cutoff), 1)\n",
" return enrichment_factor_random"
],
"metadata": {
"id": "wbjqjFRr_wqT"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def calculate_enrichment_factor_optimal(molecules, ranked_dataset_percentage_cutoff, pic50_cutoff):\n",
" \"\"\"\n",
" Get the optimal random enrichment factor for a given percentage of the ranked dataset.\n",
"\n",
" Parameters\n",
" ----------\n",
" molecules : pandas.DataFrame\n",
" the DataFrame with all the molecules and pIC50.\n",
" ranked_dataset_percentage_cutoff : float or int\n",
" Percentage of ranked dataset to be included in enrichment factor calculation.\n",
" activity_cutoff: float\n",
" pIC50 cutoff value used to discriminate active and inactive molecules\n",
"\n",
" Returns\n",
" -------\n",
" float\n",
" Optimal enrichment factor.\n",
" \"\"\"\n",
"\n",
" ratio = sum(molecules[\"pIC50\"] >= pic50_cutoff) / len(molecules) * 100\n",
" if ranked_dataset_percentage_cutoff <= ratio:\n",
" enrichment_factor_optimal = round(100 / ratio * ranked_dataset_percentage_cutoff, 1)\n",
" else:\n",
" enrichment_factor_optimal = 100.0\n",
" return enrichment_factor_optimal"
],
"metadata": {
"id": "2m4I2IHo_0pj"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"ranked_dataset_percentage_cutoff = 5"
],
"metadata": {
"id": "WbAfjid7_4MA"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"for similarity_measure, enrichment in enrichment_data.items():\n",
" enrichment_factor = calculate_enrichment_factor(enrichment, ranked_dataset_percentage_cutoff)\n",
" print(\n",
" f\"Experimental EF for {ranked_dataset_percentage_cutoff}% of ranked dataset ({similarity_measure}): {enrichment_factor}%\"\n",
" )"
],
"metadata": {
"id": "osJhc5pK_5zv"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"enrichment_factor_random = calculate_enrichment_factor_random(ranked_dataset_percentage_cutoff)\n",
"print(\n",
" f\"Random EF for {ranked_dataset_percentage_cutoff}% of ranked dataset: {enrichment_factor_random}%\"\n",
")\n",
"enrichment_factor_optimal = calculate_enrichment_factor_optimal(\n",
" molecule_dataset, ranked_dataset_percentage_cutoff, pic50_cutoff\n",
")\n",
"print(\n",
" f\"Optimal EF for {ranked_dataset_percentage_cutoff}% of ranked dataset: {enrichment_factor_optimal}%\"\n",
")\n",
"# NBVAL_CHECK_OUTPUT"
],
"metadata": {
"id": "dY2atRHUACoz"
},
"execution_count": null,
"outputs": []
}
]
}